C10H9ClF2O3 — CID 60922279
3-chloro-4-(2,2-difluoroethoxy)-5-methoxybenzaldehyde (PubChem CID 60922279) has the molecular formula C10H9ClF2O3 and a molecular weight of 250.63 g/mol. Its IUPAC name is 3-chloro-4-(2,2-difluoroethoxy)-5-methoxybenzaldehyde.
| Compound Name | 3-chloro-4-(2,2-difluoroethoxy)-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 60922279 |
| Molecular Formula | C10H9ClF2O3 |
| Molecular Weight | 250.63 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 3-chloro-4-(2,2-difluoroethoxy)-5-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(Cl)c1OCC(F)F |
| InChI | InChI=1S/C10H9ClF2O3/c1-15-8-3-6(4-14)2-7(11)10(8)16-5-9(12)13/h2-4,9H,5H2,1H3 |
| InChIKey | GOQROXXPRDLDQV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|