C15H12ClFO3 — CID 882398
3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxybenzaldehyde (PubChem CID 882398) has the molecular formula C15H12ClFO3 and a molecular weight of 294.71 g/mol. Its IUPAC name is 3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxybenzaldehyde.
| Compound Name | 3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 882398 |
| Molecular Formula | C15H12ClFO3 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(Cl)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C15H12ClFO3/c1-19-14-7-11(8-18)6-13(16)15(14)20-9-10-3-2-4-12(17)5-10/h2-8H,9H2,1H3 |
| InChIKey | ZXRHLHVARQYYTA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|