C24H22ClFN2O5 — CID 126322599
N-[(E)-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 126322599) has the molecular formula C24H22ClFN2O5 and a molecular weight of 472.90 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126322599 |
| Molecular Formula | C24H22ClFN2O5 |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C/c2cc(Cl)c(OCc3cccc(F)c3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H22ClFN2O5/c1-30-20-8-7-17(12-21(20)31-2)24(29)28-27-13-16-10-19(25)23(22(11-16)32-3)33-14-15-5-4-6-18(26)9-15/h4-13H,14H2,1-3H3,(H,28,29)/b27-13+ |
| InChIKey | XTFZLBUWQKPNSJ-UVHMKAGCSA-N |
| XLogP | 4.85 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|