C23H18Cl2N2O5 — CID 126198234
3-[[2-chloro-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126198234) has the molecular formula C23H18Cl2N2O5 and a molecular weight of 473.31 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126198234 |
| Molecular Formula | C23H18Cl2N2O5 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 3-[[2-chloro-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(Cl)cc2)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H18Cl2N2O5/c1-31-20-11-15(12-26-27-22(28)16-5-7-18(24)8-6-16)10-19(25)21(20)32-13-14-3-2-4-17(9-14)23(29)30/h2-12H,13H2,1H3,(H,27,28)(H,29,30)/b26-12- |
| InChIKey | SDQKSCSMSDSCOB-ZRGSRPPYSA-N |
| XLogP | 5.04 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|