C25H18ClN3O8 — CID 3695208
3-[[2-chloro-6-methoxy-4-[[(5-nitro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 3695208) has the molecular formula C25H18ClN3O8 and a molecular weight of 523.89 g/mol. Its IUPAC name is 3-[[2-chloro-6-methoxy-4-[[(5-nitro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-6-methoxy-4-[[(5-nitro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3695208 |
| Molecular Formula | C25H18ClN3O8 |
| Molecular Weight | 523.89 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 3-[[2-chloro-6-methoxy-4-[[(5-nitro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=NNC(=O)c2cc3cc([N+](=O)[O-])ccc3o2)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H18ClN3O8/c1-35-21-9-15(8-19(26)23(21)36-13-14-3-2-4-16(7-14)25(31)32)12-27-28-24(30)22-11-17-10-18(29(33)34)5-6-20(17)37-22/h2-12H,13H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | MYRCILRHQCNRBP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.89 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|