C25H19Br2N3O6 — CID 126194199
N-[(E)-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 126194199) has the molecular formula C25H19Br2N3O6 and a molecular weight of 617.25 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126194199 |
| Molecular Formula | C25H19Br2N3O6 |
| Molecular Weight | 617.25 g/mol |
| Exact Mass | 614.96 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Br)c(OCc4cccc([N+](=O)[O-])c4)c(Br)c3)cc2c1 |
| InChI | InChI=1S/C25H19Br2N3O6/c1-2-34-19-6-7-22-17(11-19)12-23(36-22)25(31)29-28-13-16-9-20(26)24(21(27)10-16)35-14-15-4-3-5-18(8-15)30(32)33/h3-13H,2,14H2,1H3,(H,29,31)/b28-13+ |
| InChIKey | VYKSOGCKBANXLE-XODNFHPESA-N |
| XLogP | 6.61 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.25 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|