C19H16Br2N2O4 — CID 126193167
N-[(E)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 126193167) has the molecular formula C19H16Br2N2O4 and a molecular weight of 496.16 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126193167 |
| Molecular Formula | C19H16Br2N2O4 |
| Molecular Weight | 496.16 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | N-[(E)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Br)c(OC)c(Br)c3)cc2c1 |
| InChI | InChI=1S/C19H16Br2N2O4/c1-3-26-13-4-5-16-12(8-13)9-17(27-16)19(24)23-22-10-11-6-14(20)18(25-2)15(21)7-11/h4-10H,3H2,1-2H3,(H,23,24)/b22-10+ |
| InChIKey | JOAMJSLSOCQPPU-LSHDLFTRSA-N |
| XLogP | 5.13 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.16 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|