C21H18BrIN2O6 — CID 126194635
methyl 2-[2-bromo-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-6-iodophenoxy]acetate (PubChem CID 126194635) has the molecular formula C21H18BrIN2O6 and a molecular weight of 601.19 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-6-iodophenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126194635 |
| Molecular Formula | C21H18BrIN2O6 |
| Molecular Weight | 601.19 g/mol |
| Exact Mass | 599.94 |
| IUPAC Name | methyl 2-[2-bromo-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-6-iodophenoxy]acetate |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Br)c(OCC(=O)OC)c(I)c3)cc2c1 |
| InChI | InChI=1S/C21H18BrIN2O6/c1-3-29-14-4-5-17-13(8-14)9-18(31-17)21(27)25-24-10-12-6-15(22)20(16(23)7-12)30-11-19(26)28-2/h4-10H,3,11H2,1-2H3,(H,25,27)/b24-10+ |
| InChIKey | YVYJMPRFPURGOD-YSURURNPSA-N |
| XLogP | 4.51 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|