C19H17IN2O5 — CID 137131326
5-ethoxy-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 137131326) has the molecular formula C19H17IN2O5 and a molecular weight of 480.26 g/mol. Its IUPAC name is 5-ethoxy-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-ethoxy-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 137131326 |
| Molecular Formula | C19H17IN2O5 |
| Molecular Weight | 480.26 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 5-ethoxy-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(I)c(O)c(OC)c3)cc2c1 |
| InChI | InChI=1S/C19H17IN2O5/c1-3-26-13-4-5-15-12(8-13)9-17(27-15)19(24)22-21-10-11-6-14(20)18(23)16(7-11)25-2/h4-10,23H,3H2,1-2H3,(H,22,24)/b21-10+ |
| InChIKey | FLJYQWWRIAFLGB-UFFVCSGVSA-N |
| XLogP | 3.91 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|