C22H23BrN2O5 — CID 126193862
N-[(E)-(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 126193862) has the molecular formula C22H23BrN2O5 and a molecular weight of 475.34 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126193862 |
| Molecular Formula | C22H23BrN2O5 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N-[(E)-(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Br)c(OC(C)C)c(OC)c3)cc2c1 |
| InChI | InChI=1S/C22H23BrN2O5/c1-5-28-16-6-7-18-15(10-16)11-20(30-18)22(26)25-24-12-14-8-17(23)21(29-13(2)3)19(9-14)27-4/h6-13H,5H2,1-4H3,(H,25,26)/b24-12+ |
| InChIKey | SMKPARRNCUZYEK-WYMPLXKRSA-N |
| XLogP | 5.15 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|