C23H23BrN2O7 — CID 126191355
methyl 2-[2-bromo-6-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126191355) has the molecular formula C23H23BrN2O7 and a molecular weight of 519.35 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-6-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126191355 |
| Molecular Formula | C23H23BrN2O7 |
| Molecular Weight | 519.35 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | methyl 2-[2-bromo-6-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Br)c(OCC(=O)OC)c(OCC)c3)cc2c1 |
| InChI | InChI=1S/C23H23BrN2O7/c1-4-30-16-6-7-18-15(10-16)11-20(33-18)23(28)26-25-12-14-8-17(24)22(19(9-14)31-5-2)32-13-21(27)29-3/h6-12H,4-5,13H2,1-3H3,(H,26,28)/b25-12+ |
| InChIKey | SESZXYUWWMQWFR-BRJLIKDPSA-N |
| XLogP | 4.31 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|