C27H23BrCl2N2O5 — CID 126339267
N-[(E)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 126339267) has the molecular formula C27H23BrCl2N2O5 and a molecular weight of 606.30 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126339267 |
| Molecular Formula | C27H23BrCl2N2O5 |
| Molecular Weight | 606.30 g/mol |
| Exact Mass | 604.02 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Br)c(OCc4ccc(Cl)c(Cl)c4)c(OCC)c3)cc2c1 |
| InChI | InChI=1S/C27H23BrCl2N2O5/c1-3-34-19-6-8-23-18(12-19)13-25(37-23)27(33)32-31-14-17-9-20(28)26(24(11-17)35-4-2)36-15-16-5-7-21(29)22(30)10-16/h5-14H,3-4,15H2,1-2H3,(H,32,33)/b31-14+ |
| InChIKey | CJABMRKMHROYES-XAZZYMPDSA-N |
| XLogP | 7.64 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.30 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|