C28H25BrN2O7 — CID 126193974
3-[[2-bromo-6-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126193974) has the molecular formula C28H25BrN2O7 and a molecular weight of 581.42 g/mol. Its IUPAC name is 3-[[2-bromo-6-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-6-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126193974 |
| Molecular Formula | C28H25BrN2O7 |
| Molecular Weight | 581.42 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | 3-[[2-bromo-6-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Br)c(OCc4cccc(C(=O)O)c4)c(OCC)c3)cc2c1 |
| InChI | InChI=1S/C28H25BrN2O7/c1-3-35-21-8-9-23-20(13-21)14-25(38-23)27(32)31-30-15-18-11-22(29)26(24(12-18)36-4-2)37-16-17-6-5-7-19(10-17)28(33)34/h5-15H,3-4,16H2,1-2H3,(H,31,32)(H,33,34)/b30-15+ |
| InChIKey | UFONSISOUISZME-FJEPWZHXSA-N |
| XLogP | 6.03 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|