C27H24BrFN2O5 — CID 21169840
N-[(Z)-[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 21169840) has the molecular formula C27H24BrFN2O5 and a molecular weight of 555.40 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21169840 |
| Molecular Formula | C27H24BrFN2O5 |
| Molecular Weight | 555.40 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C\c3cc(Br)c(OCc4ccc(F)cc4)c(OCC)c3)cc2c1 |
| InChI | InChI=1S/C27H24BrFN2O5/c1-3-33-21-9-10-23-19(13-21)14-25(36-23)27(32)31-30-15-18-11-22(28)26(24(12-18)34-4-2)35-16-17-5-7-20(29)8-6-17/h5-15H,3-4,16H2,1-2H3,(H,31,32)/b30-15- |
| InChIKey | QROSYCMYGGLXRU-MNDYBZJGSA-N |
| XLogP | 6.47 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.40 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|