C31H27BrN2O5 — CID 126193366
N-[(E)-[3-bromo-5-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 126193366) has the molecular formula C31H27BrN2O5 and a molecular weight of 587.47 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-[3-bromo-5-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126193366 |
| Molecular Formula | C31H27BrN2O5 |
| Molecular Weight | 587.47 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | N-[(E)-[3-bromo-5-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Br)c(OCc4ccc5ccccc5c4)c(OCC)c3)cc2c1 |
| InChI | InChI=1S/C31H27BrN2O5/c1-3-36-25-11-12-27-24(16-25)17-29(39-27)31(35)34-33-18-21-14-26(32)30(28(15-21)37-4-2)38-19-20-9-10-22-7-5-6-8-23(22)13-20/h5-18H,3-4,19H2,1-2H3,(H,34,35)/b33-18+ |
| InChIKey | MHFARCAYKKIFKZ-DPNNOFEESA-N |
| XLogP | 7.49 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.47 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|