C20H19ClN2O5 — CID 137131398
N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 137131398) has the molecular formula C20H19ClN2O5 and a molecular weight of 402.83 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 137131398 |
| Molecular Formula | C20H19ClN2O5 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Cl)c(O)c(OCC)c3)cc2c1 |
| InChI | InChI=1S/C20H19ClN2O5/c1-3-26-14-5-6-16-13(9-14)10-18(28-16)20(25)23-22-11-12-7-15(21)19(24)17(8-12)27-4-2/h5-11,24H,3-4H2,1-2H3,(H,23,25)/b22-11+ |
| InChIKey | XACFRFBBOIDPCF-SSDVNMTOSA-N |
| XLogP | 4.35 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|