C22H23IN2O5 — CID 126191027
N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 126191027) has the molecular formula C22H23IN2O5 and a molecular weight of 522.34 g/mol. Its IUPAC name is N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126191027 |
| Molecular Formula | C22H23IN2O5 |
| Molecular Weight | 522.34 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(I)c(OCC)c(OCC)c3)cc2c1 |
| InChI | InChI=1S/C22H23IN2O5/c1-4-27-16-7-8-18-15(11-16)12-20(30-18)22(26)25-24-13-14-9-17(23)21(29-6-3)19(10-14)28-5-2/h7-13H,4-6H2,1-3H3,(H,25,26)/b24-13+ |
| InChIKey | NEUAWZVRAAFZGF-ZMOGYAJESA-N |
| XLogP | 5.00 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|