C22H20ClIN2O6 — CID 126025055
ethyl 2-[4-[(E)-[(5-chloro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 126025055) has the molecular formula C22H20ClIN2O6 and a molecular weight of 570.77 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[(5-chloro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[(5-chloro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126025055 |
| Molecular Formula | C22H20ClIN2O6 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | ethyl 2-[4-[(E)-[(5-chloro-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=N/NC(=O)c2cc3cc(Cl)ccc3o2)cc1OCC |
| InChI | InChI=1S/C22H20ClIN2O6/c1-3-29-18-8-13(7-16(24)21(18)31-12-20(27)30-4-2)11-25-26-22(28)19-10-14-9-15(23)5-6-17(14)32-19/h5-11H,3-4,12H2,1-2H3,(H,26,28)/b25-11+ |
| InChIKey | MGSOKVBXVDXWLC-OPEKNORGSA-N |
| XLogP | 4.80 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|