C24H17ClI2N2O3 — CID 126022815
5-chloro-N-[(E)-[3,5-diiodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126022815) has the molecular formula C24H17ClI2N2O3 and a molecular weight of 670.67 g/mol. Its IUPAC name is 5-chloro-N-[(E)-[3,5-diiodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(E)-[3,5-diiodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126022815 |
| Molecular Formula | C24H17ClI2N2O3 |
| Molecular Weight | 670.67 g/mol |
| Exact Mass | 669.90 |
| IUPAC Name | 5-chloro-N-[(E)-[3,5-diiodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(COc2c(I)cc(/C=N/NC(=O)c3cc4cc(Cl)ccc4o3)cc2I)cc1 |
| InChI | InChI=1S/C24H17ClI2N2O3/c1-14-2-4-15(5-3-14)13-31-23-19(26)8-16(9-20(23)27)12-28-29-24(30)22-11-17-10-18(25)6-7-21(17)32-22/h2-12H,13H2,1H3,(H,29,30)/b28-12+ |
| InChIKey | FZADCSVKEJNOPF-KVSWJAHQSA-N |
| XLogP | 6.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.67 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|