C23H13Cl5N2O3 — CID 126028772
5-chloro-N-[(E)-[3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126028772) has the molecular formula C23H13Cl5N2O3 and a molecular weight of 542.63 g/mol. Its IUPAC name is 5-chloro-N-[(E)-[3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(E)-[3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126028772 |
| Molecular Formula | C23H13Cl5N2O3 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 539.94 |
| IUPAC Name | 5-chloro-N-[(E)-[3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Cl)c(OCc2ccc(Cl)c(Cl)c2)c(Cl)c1)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C23H13Cl5N2O3/c24-15-2-4-20-14(8-15)9-21(33-20)23(31)30-29-10-13-6-18(27)22(19(28)7-13)32-11-12-1-3-16(25)17(26)5-12/h1-10H,11H2,(H,30,31)/b29-10+ |
| InChIKey | IFIDNBXYIFSJHG-VYVUJPJFSA-N |
| XLogP | 8.04 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|