C23H16BrClN2O3 — CID 126023954
N-[(E)-(3-bromo-4-phenylmethoxyphenyl)methylideneamino]-5-chloro-1-benzofuran-2-carboxamide (PubChem CID 126023954) has the molecular formula C23H16BrClN2O3 and a molecular weight of 483.75 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-phenylmethoxyphenyl)methylideneamino]-5-chloro-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-(3-bromo-4-phenylmethoxyphenyl)methylideneamino]-5-chloro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126023954 |
| Molecular Formula | C23H16BrClN2O3 |
| Molecular Weight | 483.75 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | N-[(E)-(3-bromo-4-phenylmethoxyphenyl)methylideneamino]-5-chloro-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(OCc2ccccc2)c(Br)c1)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C23H16BrClN2O3/c24-19-10-16(6-8-21(19)29-14-15-4-2-1-3-5-15)13-26-27-23(28)22-12-17-11-18(25)7-9-20(17)30-22/h1-13H,14H2,(H,27,28)/b26-13+ |
| InChIKey | NPYIBMFFWBAUPK-LGJNPRDNSA-N |
| XLogP | 6.19 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|