C23H13Br2Cl3N2O3 — CID 126024892
5-chloro-N-[(E)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126024892) has the molecular formula C23H13Br2Cl3N2O3 and a molecular weight of 631.54 g/mol. Its IUPAC name is 5-chloro-N-[(E)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(E)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126024892 |
| Molecular Formula | C23H13Br2Cl3N2O3 |
| Molecular Weight | 631.54 g/mol |
| Exact Mass | 627.84 |
| IUPAC Name | 5-chloro-N-[(E)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(OCc2ccc(Cl)cc2Cl)c(Br)c1)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C23H13Br2Cl3N2O3/c24-17-5-12(6-18(25)22(17)32-11-13-1-2-16(27)9-19(13)28)10-29-30-23(31)21-8-14-7-15(26)3-4-20(14)33-21/h1-10H,11H2,(H,30,31)/b29-10+ |
| InChIKey | KTGZMOKXJOVWKC-VYVUJPJFSA-N |
| XLogP | 8.26 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.54 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|