C24H18Cl2N2O4 — CID 124541267
N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 124541267) has the molecular formula C24H18Cl2N2O4 and a molecular weight of 469.32 g/mol. Its IUPAC name is N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 124541267 |
| Molecular Formula | C24H18Cl2N2O4 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc3ccccc3o2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H18Cl2N2O4/c1-30-22-10-15(6-9-21(22)31-14-17-7-8-18(25)12-19(17)26)13-27-28-24(29)23-11-16-4-2-3-5-20(16)32-23/h2-13H,14H2,1H3,(H,28,29)/b27-13+ |
| InChIKey | HANXCYKXMAOOQW-UVHMKAGCSA-N |
| XLogP | 6.09 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|