C22H17Cl3N2O3 — CID 94851424
3-chloro-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide (PubChem CID 94851424) has the molecular formula C22H17Cl3N2O3 and a molecular weight of 463.75 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 94851424 |
| Molecular Formula | C22H17Cl3N2O3 |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 3-chloro-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cccc(Cl)c2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl3N2O3/c1-29-21-9-14(12-26-27-22(28)15-3-2-4-17(23)10-15)5-8-20(21)30-13-16-6-7-18(24)11-19(16)25/h2-12H,13H2,1H3,(H,27,28)/b26-12- |
| InChIKey | IEZQCWGRTJSFOD-ZRGSRPPYSA-N |
| XLogP | 6.00 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|