C22H18Cl2N2O3 — CID 19169715
4-chloro-N-[(E)-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide (PubChem CID 19169715) has the molecular formula C22H18Cl2N2O3 and a molecular weight of 429.30 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 19169715 |
| Molecular Formula | C22H18Cl2N2O3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 4-chloro-N-[(E)-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(Cl)cc2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H18Cl2N2O3/c1-28-21-12-15(13-25-26-22(27)16-7-9-18(23)10-8-16)6-11-20(21)29-14-17-4-2-3-5-19(17)24/h2-13H,14H2,1H3,(H,26,27)/b25-13+ |
| InChIKey | OBDYPPUUTNCSGJ-DHRITJCHSA-N |
| XLogP | 5.34 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|