C23H14Br2Cl2N2O3 — CID 21375524
5,7-dibromo-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21375524) has the molecular formula C23H14Br2Cl2N2O3 and a molecular weight of 597.09 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375524 |
| Molecular Formula | C23H14Br2Cl2N2O3 |
| Molecular Weight | 597.09 g/mol |
| Exact Mass | 593.87 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccc(Cl)cc2Cl)cc1)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C23H14Br2Cl2N2O3/c24-16-7-15-8-21(32-22(15)19(25)9-16)23(30)29-28-11-13-1-5-18(6-2-13)31-12-14-3-4-17(26)10-20(14)27/h1-11H,12H2,(H,29,30)/b28-11- |
| InChIKey | IKLCFEAABHOUAA-FXMZOFOKSA-N |
| XLogP | 7.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.09 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|