C18H13Br2N3O4 — CID 21376390
N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide (PubChem CID 21376390) has the molecular formula C18H13Br2N3O4 and a molecular weight of 495.13 g/mol. Its IUPAC name is N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376390 |
| Molecular Formula | C18H13Br2N3O4 |
| Molecular Weight | 495.13 g/mol |
| Exact Mass | 492.93 |
| IUPAC Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)COc1ccc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)cc1 |
| InChI | InChI=1S/C18H13Br2N3O4/c19-12-5-11-6-15(27-17(11)14(20)7-12)18(25)23-22-8-10-1-3-13(4-2-10)26-9-16(21)24/h1-8H,9H2,(H2,21,24)(H,23,25)/b22-8- |
| InChIKey | QPZYCTPHWSSEKL-UYOCIXKTSA-N |
| XLogP | 3.59 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.13 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|