C19H13Br2N3O4 — CID 126381031
5,7-dibromo-N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126381031) has the molecular formula C19H13Br2N3O4 and a molecular weight of 507.14 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126381031 |
| Molecular Formula | C19H13Br2N3O4 |
| Molecular Weight | 507.14 g/mol |
| Exact Mass | 504.93 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)ccc1OCC#N |
| InChI | InChI=1S/C19H13Br2N3O4/c1-26-16-6-11(2-3-15(16)27-5-4-22)10-23-24-19(25)17-8-12-7-13(20)9-14(21)18(12)28-17/h2-3,6-10H,5H2,1H3,(H,24,25)/b23-10- |
| InChIKey | YCGKUWHPJGDMHY-RMORIDSASA-N |
| XLogP | 4.63 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.14 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|