C15H13BrN4O3 — CID 8982987
4-bromo-N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 8982987) has the molecular formula C15H13BrN4O3 and a molecular weight of 377.20 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8982987 |
| Molecular Formula | C15H13BrN4O3 |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 4-bromo-N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc(Br)c[nH]2)ccc1OCC#N |
| InChI | InChI=1S/C15H13BrN4O3/c1-22-14-6-10(2-3-13(14)23-5-4-17)8-19-20-15(21)12-7-11(16)9-18-12/h2-3,6-9,18H,5H2,1H3,(H,20,21)/b19-8- |
| InChIKey | YSDFQFWYUYQOSZ-UWVJOHFNSA-N |
| XLogP | 2.45 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|