C20H17N5O4 — CID 55352186
N-[(E)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-4-hydroxy-1-phenylpyrazole-3-carboxamide (PubChem CID 55352186) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is N-[(E)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-4-hydroxy-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[(E)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-4-hydroxy-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55352186 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[(E)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-4-hydroxy-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2nn(-c3ccccc3)cc2O)ccc1OCC#N |
| InChI | InChI=1S/C20H17N5O4/c1-28-18-11-14(7-8-17(18)29-10-9-21)12-22-23-20(27)19-16(26)13-25(24-19)15-5-3-2-4-6-15/h2-8,11-13,26H,10H2,1H3,(H,23,27)/b22-12+ |
| InChIKey | STSYPZWUAZEQLO-WSDLNYQXSA-N |
| XLogP | 2.25 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|