C32H30N4O6 — CID 70231096
N-[[4-[2-[4-[(benzoylhydrazinylidene)methyl]-2-methoxyphenoxy]ethoxy]-3-methoxyphenyl]methylideneamino]benzamide (PubChem CID 70231096) has the molecular formula C32H30N4O6 and a molecular weight of 566.61 g/mol. Its IUPAC name is N-[[4-[2-[4-[(benzoylhydrazinylidene)methyl]-2-methoxyphenoxy]ethoxy]-3-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | N-[[4-[2-[4-[(benzoylhydrazinylidene)methyl]-2-methoxyphenoxy]ethoxy]-3-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 70231096 |
| Molecular Formula | C32H30N4O6 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | N-[[4-[2-[4-[(benzoylhydrazinylidene)methyl]-2-methoxyphenoxy]ethoxy]-3-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccccc2)ccc1OCCOc1ccc(C=NNC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C32H30N4O6/c1-39-29-19-23(21-33-35-31(37)25-9-5-3-6-10-25)13-15-27(29)41-17-18-42-28-16-14-24(20-30(28)40-2)22-34-36-32(38)26-11-7-4-8-12-26/h3-16,19-22H,17-18H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | RNTMQGJVDNLJKN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|