C26H28N2O4 — CID 5158014
N-[[4-[3-(2,3-dimethylphenoxy)propoxy]-3-methoxyphenyl]methylideneamino]benzamide (PubChem CID 5158014) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[[4-[3-(2,3-dimethylphenoxy)propoxy]-3-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | N-[[4-[3-(2,3-dimethylphenoxy)propoxy]-3-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 5158014 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[[4-[3-(2,3-dimethylphenoxy)propoxy]-3-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccccc2)ccc1OCCCOc1cccc(C)c1C |
| InChI | InChI=1S/C26H28N2O4/c1-19-9-7-12-23(20(19)2)31-15-8-16-32-24-14-13-21(17-25(24)30-3)18-27-28-26(29)22-10-5-4-6-11-22/h4-7,9-14,17-18H,8,15-16H2,1-3H3,(H,28,29) |
| InChIKey | JWVMZDSPACXIDM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|