C23H30N2O5 — CID 126324922
3-ethoxy-N-[(E)-(3-methoxy-4-propoxyphenyl)methylideneamino]-4-propoxybenzamide (PubChem CID 126324922) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3-ethoxy-N-[(E)-(3-methoxy-4-propoxyphenyl)methylideneamino]-4-propoxybenzamide.
| Compound Name | 3-ethoxy-N-[(E)-(3-methoxy-4-propoxyphenyl)methylideneamino]-4-propoxybenzamide |
|---|---|
| PubChem CID | 126324922 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 3-ethoxy-N-[(E)-(3-methoxy-4-propoxyphenyl)methylideneamino]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(/C=N/NC(=O)c2ccc(OCCC)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C23H30N2O5/c1-5-12-29-19-10-8-17(14-21(19)27-4)16-24-25-23(26)18-9-11-20(30-13-6-2)22(15-18)28-7-3/h8-11,14-16H,5-7,12-13H2,1-4H3,(H,25,26)/b24-16+ |
| InChIKey | ZLWANQGIOIPVSW-LFVJCYFKSA-N |
| XLogP | 4.44 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|