C22H27IN2O5 — CID 126320076
3-ethoxy-N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-4-propoxybenzamide (PubChem CID 126320076) has the molecular formula C22H27IN2O5 and a molecular weight of 526.37 g/mol. Its IUPAC name is 3-ethoxy-N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-4-propoxybenzamide.
| Compound Name | 3-ethoxy-N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-4-propoxybenzamide |
|---|---|
| PubChem CID | 126320076 |
| Molecular Formula | C22H27IN2O5 |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 3-ethoxy-N-[(E)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(I)c(OCC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C22H27IN2O5/c1-5-10-30-18-9-8-16(13-19(18)28-6-2)22(26)25-24-14-15-11-17(23)21(29-7-3)20(12-15)27-4/h8-9,11-14H,5-7,10H2,1-4H3,(H,25,26)/b24-14+ |
| InChIKey | JJZHKZYUSBWUMY-ZVHZXABRSA-N |
| XLogP | 4.65 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|