C19H21IN2O5 — CID 137068545
3,4-diethoxy-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]benzamide (PubChem CID 137068545) has the molecular formula C19H21IN2O5 and a molecular weight of 484.29 g/mol. Its IUPAC name is 3,4-diethoxy-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3,4-diethoxy-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137068545 |
| Molecular Formula | C19H21IN2O5 |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 3,4-diethoxy-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]benzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(I)c(O)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C19H21IN2O5/c1-4-26-15-7-6-13(10-16(15)27-5-2)19(24)22-21-11-12-8-14(20)18(23)17(9-12)25-3/h6-11,23H,4-5H2,1-3H3,(H,22,24)/b21-11+ |
| InChIKey | YTGVYOFIRIJSPK-SRZZPIQSSA-N |
| XLogP | 3.57 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|