C18H19IN2O5 — CID 135614416
2-(2-ethoxyphenoxy)-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]acetamide (PubChem CID 135614416) has the molecular formula C18H19IN2O5 and a molecular weight of 470.26 g/mol. Its IUPAC name is 2-(2-ethoxyphenoxy)-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-ethoxyphenoxy)-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135614416 |
| Molecular Formula | C18H19IN2O5 |
| Molecular Weight | 470.26 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 2-(2-ethoxyphenoxy)-N-[(E)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccccc1OCC(=O)N/N=C/c1cc(I)c(O)c(OC)c1 |
| InChI | InChI=1S/C18H19IN2O5/c1-3-25-14-6-4-5-7-15(14)26-11-17(22)21-20-10-12-8-13(19)18(23)16(9-12)24-2/h4-10,23H,3,11H2,1-2H3,(H,21,22)/b20-10+ |
| InChIKey | WRJOFDRPOVJJID-KEBDBYFISA-N |
| XLogP | 2.93 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|