C20H22IN3O6 — CID 3987065
N-[2-[2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 3987065) has the molecular formula C20H22IN3O6 and a molecular weight of 527.32 g/mol. Its IUPAC name is N-[2-[2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3987065 |
| Molecular Formula | C20H22IN3O6 |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | N-[2-[2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | CCOc1cc(C=NNC(=O)CNC(=O)c2ccc(OC)c(OC)c2)cc(I)c1O |
| InChI | InChI=1S/C20H22IN3O6/c1-4-30-17-8-12(7-14(21)19(17)26)10-23-24-18(25)11-22-20(27)13-5-6-15(28-2)16(9-13)29-3/h5-10,26H,4,11H2,1-3H3,(H,22,27)(H,24,25) |
| InChIKey | ADGLFUJZCXGHHO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|