C23H26BrN3O8 — CID 5236397
methyl 2-[2-bromo-4-[[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate (PubChem CID 5236397) has the molecular formula C23H26BrN3O8 and a molecular weight of 552.38 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 5236397 |
| Molecular Formula | C23H26BrN3O8 |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | methyl 2-[2-bromo-4-[[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(C=NNC(=O)CNC(=O)c2ccc(OC)c(OC)c2)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C23H26BrN3O8/c1-5-34-19-9-14(8-16(24)22(19)35-13-21(29)33-4)11-26-27-20(28)12-25-23(30)15-6-7-17(31-2)18(10-15)32-3/h6-11H,5,12-13H2,1-4H3,(H,25,30)(H,27,28) |
| InChIKey | VAYUQHHHGAOVRQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|