C19H18BrClN2O5 — CID 126198692
methyl 2-[2-bromo-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate (PubChem CID 126198692) has the molecular formula C19H18BrClN2O5 and a molecular weight of 469.72 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126198692 |
| Molecular Formula | C19H18BrClN2O5 |
| Molecular Weight | 469.72 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | methyl 2-[2-bromo-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(Cl)cc2)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C19H18BrClN2O5/c1-3-27-16-9-12(8-15(20)18(16)28-11-17(24)26-2)10-22-23-19(25)13-4-6-14(21)7-5-13/h4-10H,3,11H2,1-2H3,(H,23,25)/b22-10- |
| InChIKey | CYHIVMIZNHSUJW-YVNNLAQVSA-N |
| XLogP | 3.82 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|