C24H21BrClN3O4 — CID 126200418
N-[(Z)-[4-(2-anilino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylideneamino]-4-chlorobenzamide (PubChem CID 126200418) has the molecular formula C24H21BrClN3O4 and a molecular weight of 530.81 g/mol. Its IUPAC name is N-[(Z)-[4-(2-anilino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylideneamino]-4-chlorobenzamide.
| Compound Name | N-[(Z)-[4-(2-anilino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylideneamino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 126200418 |
| Molecular Formula | C24H21BrClN3O4 |
| Molecular Weight | 530.81 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | N-[(Z)-[4-(2-anilino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]methylideneamino]-4-chlorobenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(Cl)cc2)cc(Br)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H21BrClN3O4/c1-2-32-21-13-16(14-27-29-24(31)17-8-10-18(26)11-9-17)12-20(25)23(21)33-15-22(30)28-19-6-4-3-5-7-19/h3-14H,2,15H2,1H3,(H,28,30)(H,29,31)/b27-14- |
| InChIKey | OGOPAXXXEQXZCW-VYYCAZPPSA-N |
| XLogP | 5.28 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.81 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|