C26H25Br2N3O4 — CID 126014183
N-[(E)-[3-bromo-4-[2-(2-bromo-4,5-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide (PubChem CID 126014183) has the molecular formula C26H25Br2N3O4 and a molecular weight of 603.31 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[2-(2-bromo-4,5-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[3-bromo-4-[2-(2-bromo-4,5-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126014183 |
| Molecular Formula | C26H25Br2N3O4 |
| Molecular Weight | 603.31 g/mol |
| Exact Mass | 601.02 |
| IUPAC Name | N-[(E)-[3-bromo-4-[2-(2-bromo-4,5-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccccc2)cc(Br)c1OCC(=O)Nc1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C26H25Br2N3O4/c1-4-34-23-13-18(14-29-31-26(33)19-8-6-5-7-9-19)12-21(28)25(23)35-15-24(32)30-22-11-17(3)16(2)10-20(22)27/h5-14H,4,15H2,1-3H3,(H,30,32)(H,31,33)/b29-14+ |
| InChIKey | PMRHWARCOORLEL-IPPBACCNSA-N |
| XLogP | 6.01 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.31 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|