C34H34BrN3O6 — CID 126258167
N-[(E)-[3-bromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126258167) has the molecular formula C34H34BrN3O6 and a molecular weight of 660.57 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126258167 |
| Molecular Formula | C34H34BrN3O6 |
| Molecular Weight | 660.57 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | N-[(E)-[3-bromo-4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2cc(Br)c(OCC(=O)Nc3cccc(C)c3C)c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H34BrN3O6/c1-5-42-30-18-26(14-15-29(30)43-20-24-11-7-6-8-12-24)34(40)38-36-19-25-16-27(35)33(31(17-25)41-4)44-21-32(39)37-28-13-9-10-22(2)23(28)3/h6-19H,5,20-21H2,1-4H3,(H,37,39)(H,38,40)/b36-19+ |
| InChIKey | AZFHEJKIORXSLH-ODNPBWNPSA-N |
| XLogP | 6.83 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|