C33H31Br2N3O5 — CID 126260999
N-[(E)-[3,5-dibromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide (PubChem CID 126260999) has the molecular formula C33H31Br2N3O5 and a molecular weight of 709.44 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126260999 |
| Molecular Formula | C33H31Br2N3O5 |
| Molecular Weight | 709.44 g/mol |
| Exact Mass | 707.06 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-ethoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2cc(Br)c(OCC(=O)Nc3cc(C)ccc3C)c(Br)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H31Br2N3O5/c1-4-41-30-17-25(12-13-29(30)42-19-23-8-6-5-7-9-23)33(40)38-36-18-24-15-26(34)32(27(35)16-24)43-20-31(39)37-28-14-21(2)10-11-22(28)3/h5-18H,4,19-20H2,1-3H3,(H,37,39)(H,38,40)/b36-18+ |
| InChIKey | GDZWKZPWYIGTNN-IZYHBKOJSA-N |
| XLogP | 7.59 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.44 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|