C27H27Br2N3O5 — CID 126326052
N-[(E)-[3,5-dibromo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide (PubChem CID 126326052) has the molecular formula C27H27Br2N3O5 and a molecular weight of 633.34 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 126326052 |
| Molecular Formula | C27H27Br2N3O5 |
| Molecular Weight | 633.34 g/mol |
| Exact Mass | 631.03 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OCC(=O)Nc3ccc(C)cc3)c(Br)c2)cc1OCC |
| InChI | InChI=1S/C27H27Br2N3O5/c1-4-35-23-11-8-19(14-24(23)36-5-2)27(34)32-30-15-18-12-21(28)26(22(29)13-18)37-16-25(33)31-20-9-6-17(3)7-10-20/h6-15H,4-5,16H2,1-3H3,(H,31,33)(H,32,34)/b30-15+ |
| InChIKey | NLVJEMURCIXDQK-FJEPWZHXSA-N |
| XLogP | 6.10 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.34 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|