C26H25BrClN3O5 — CID 126327696
N-[(E)-[3-bromo-4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide (PubChem CID 126327696) has the molecular formula C26H25BrClN3O5 and a molecular weight of 574.86 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 126327696 |
| Molecular Formula | C26H25BrClN3O5 |
| Molecular Weight | 574.86 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | N-[(E)-[3-bromo-4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2ccc(OCC(=O)Nc3ccc(Cl)cc3)c(Br)c2)cc1OCC |
| InChI | InChI=1S/C26H25BrClN3O5/c1-3-34-23-12-6-18(14-24(23)35-4-2)26(33)31-29-15-17-5-11-22(21(27)13-17)36-16-25(32)30-20-9-7-19(28)8-10-20/h5-15H,3-4,16H2,1-2H3,(H,30,32)(H,31,33)/b29-15+ |
| InChIKey | IGJAFOHAQAAWFV-WKULSOCRSA-N |
| XLogP | 5.68 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.86 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|