C25H23Cl2N3O5 — CID 126319509
N-[(E)-[3-chloro-4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide (PubChem CID 126319509) has the molecular formula C25H23Cl2N3O5 and a molecular weight of 516.38 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 126319509 |
| Molecular Formula | C25H23Cl2N3O5 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | N-[(E)-[3-chloro-4-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2ccc(OCC(=O)Nc3ccc(Cl)cc3)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C25H23Cl2N3O5/c1-3-34-22-11-5-17(13-23(22)33-2)25(32)30-28-14-16-4-10-21(20(27)12-16)35-15-24(31)29-19-8-6-18(26)7-9-19/h4-14H,3,15H2,1-2H3,(H,29,31)(H,30,32)/b28-14+ |
| InChIKey | IQXYOFAGFMDLHY-CCVNUDIWSA-N |
| XLogP | 5.18 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|