C26H27N3O6 — CID 3517800
N-[[4-(2-anilino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 3517800) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is N-[[4-(2-anilino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[[4-(2-anilino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3517800 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[[4-(2-anilino-2-oxoethoxy)-3-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | CCOc1cc(C=NNC(=O)c2ccc(OC)c(OC)c2)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H27N3O6/c1-4-34-24-14-18(10-12-22(24)35-17-25(30)28-20-8-6-5-7-9-20)16-27-29-26(31)19-11-13-21(32-2)23(15-19)33-3/h5-16H,4,17H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | GYXGAIRKJMLYGF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|