C32H30IN3O6 — CID 126323799
N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 126323799) has the molecular formula C32H30IN3O6 and a molecular weight of 679.51 g/mol. Its IUPAC name is N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126323799 |
| Molecular Formula | C32H30IN3O6 |
| Molecular Weight | 679.51 g/mol |
| Exact Mass | 679.12 |
| IUPAC Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(OCc3ccccc3)c(OC)c2)cc(I)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C32H30IN3O6/c1-3-40-29-17-23(16-26(33)31(29)42-21-30(37)35-25-12-8-5-9-13-25)19-34-36-32(38)24-14-15-27(28(18-24)39-2)41-20-22-10-6-4-7-11-22/h4-19H,3,20-21H2,1-2H3,(H,35,37)(H,36,38)/b34-19+ |
| InChIKey | RNKLJEJQSDVRRX-ALQBTCKLSA-N |
| XLogP | 6.06 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|