C27H28IN3O6 — CID 126322604
N-[(E)-[3-ethoxy-5-iodo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 126322604) has the molecular formula C27H28IN3O6 and a molecular weight of 617.44 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-5-iodo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-[3-ethoxy-5-iodo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126322604 |
| Molecular Formula | C27H28IN3O6 |
| Molecular Weight | 617.44 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | N-[(E)-[3-ethoxy-5-iodo-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(OC)c(OC)c2)cc(I)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C27H28IN3O6/c1-5-36-24-13-18(15-29-31-27(33)19-8-11-22(34-3)23(14-19)35-4)12-21(28)26(24)37-16-25(32)30-20-9-6-17(2)7-10-20/h6-15H,5,16H2,1-4H3,(H,30,32)(H,31,33)/b29-15+ |
| InChIKey | QJMQRVYWVLJWCJ-WKULSOCRSA-N |
| XLogP | 4.80 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|