C28H30BrN3O6 — CID 126307211
N-[(E)-[3-bromo-5-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide (PubChem CID 126307211) has the molecular formula C28H30BrN3O6 and a molecular weight of 584.47 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-5-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 126307211 |
| Molecular Formula | C28H30BrN3O6 |
| Molecular Weight | 584.47 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | N-[(E)-[3-bromo-5-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OCC(=O)Nc3ccc(C)cc3)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C28H30BrN3O6/c1-5-36-23-12-9-20(15-24(23)37-6-2)28(34)32-30-16-19-13-22(29)27(25(14-19)35-4)38-17-26(33)31-21-10-7-18(3)8-11-21/h7-16H,5-6,17H2,1-4H3,(H,31,33)(H,32,34)/b30-16+ |
| InChIKey | CLYRSFXSKLKBKS-OKCVXOCRSA-N |
| XLogP | 5.34 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|